Reaction Scheme
aryl halide + boronic acid -> biarylPd catalyst, base, often aqueous organic solvent.
Primary reaction SMILES: B(O)(O)c1ccccc1.Brc1ccccc1>>c1ccc(-c2ccccc2)cc1
Organic reaction
Suzuki Coupling
Suzuki coupling, also called Suzuki-Miyaura coupling, forms carbon-carbon bonds between organoboron reagents and aryl or vinyl halides under palladium catalysis.
Two Common Examples
Bromobenzene + phenylboronic acid
Forms biphenyl under Pd/base conditions.
Aryl bromide + heteroaryl boronic acid
Common in medicinal chemistry library synthesis.
MolDraw Use
Sketch the halide, boronic acid, catalyst, base, and coupled product for reports or retrosynthesis notes.